diff options
author | Joel Sherrill <joel.sherrill@OARcorp.com> | 1998-06-22 11:09:32 +0000 |
---|---|---|
committer | Joel Sherrill <joel.sherrill@OARcorp.com> | 1998-06-22 11:09:32 +0000 |
commit | ab2dbd7e947b5dfa35a94f0864743e346b971e73 (patch) | |
tree | b847a95a946a08f664e3d3cdb56b38cefd701f6b /c/src/lib | |
parent | Moved get and set register/data typedefs to this file. (diff) | |
download | rtems-ab2dbd7e947b5dfa35a94f0864743e346b971e73.tar.bz2 |
Added mc68681 stuff to the makefile.
Added numerous constants to mc68681_p.h.
Changed spacing.
At this point the polled support is in but nothing else is right except the
structure.
Diffstat (limited to 'c/src/lib')
-rw-r--r-- | c/src/lib/libchip/serial/Makefile.in | 4 | ||||
-rw-r--r-- | c/src/lib/libchip/serial/mc68681.c | 178 | ||||
-rw-r--r-- | c/src/lib/libchip/serial/mc68681.h | 9 | ||||
-rw-r--r-- | c/src/lib/libchip/serial/mc68681_p.h | 243 |
4 files changed, 344 insertions, 90 deletions
diff --git a/c/src/lib/libchip/serial/Makefile.in b/c/src/lib/libchip/serial/Makefile.in index 079da2d27b..11db0b9af1 100644 --- a/c/src/lib/libchip/serial/Makefile.in +++ b/c/src/lib/libchip/serial/Makefile.in @@ -11,11 +11,11 @@ PROJECT_ROOT = @PROJECT_ROOT@ LIBNAME=libserialio.a LIB=${ARCH}/${LIBNAME} -C_PIECES=ns16550 z85c30 +C_PIECES=mc68681 ns16550 z85c30 C_FILES=$(C_PIECES:%=%.c) C_O_FILES=$(C_PIECES:%=${ARCH}/%.o) -INSTALLED_H_FILES=$(srcdir)/ns16550.h $(srcdir)/z85c30.h \ +INSTALLED_H_FILES=$(srcdir)/mc68681.h $(srcdir)/ns16550.h $(srcdir)/z85c30.h \ $(srcdir)/serial.h SRCS=$(C_FILES) $(H_FILES) $(SYS_H_FILES) $(RTEMS_H_FILES) $(PRIVATE_H_FILES) OBJS=$(C_O_FILES) diff --git a/c/src/lib/libchip/serial/mc68681.c b/c/src/lib/libchip/serial/mc68681.c index 5461484a7a..1a0c36cbf1 100644 --- a/c/src/lib/libchip/serial/mc68681.c +++ b/c/src/lib/libchip/serial/mc68681.c @@ -24,6 +24,7 @@ #include <libchip/serial.h> #include "mc68681_p.h" +#include "mc68681.h" /* * Flow control is only supported when using interrupts @@ -68,20 +69,13 @@ console_fns mc68681_fns_polled = extern void set_vector( rtems_isr_entry, rtems_vector_number, int ); /* - * Types for get and set register routines - */ - -typedef unsigned8 (*getRegister_f)(unsigned32 port, unsigned8 register); -typedef void (*setRegister_f)( - unsigned32 port, unsigned8 reg, unsigned8 value); -/* * Console Device Driver Entry Points */ static boolean mc68681_probe(int minor) { /* - * If the configuration dependant probe has located the device then + * If the configuration dependent probe has located the device then * assume it is there */ return(TRUE); @@ -89,63 +83,71 @@ static boolean mc68681_probe(int minor) static void mc68681_init(int minor) { +/* XXX */ unsigned32 pMC68681; unsigned8 ucTrash; unsigned8 ucDataByte; unsigned32 ulBaudDivisor; - mc68681_context *pns68681Context; + mc68681_context *pmc68681Context; setRegister_f setReg; getRegister_f getReg; - pmc68681Context=(ns68681_context *)malloc(sizeof(mc68681_context)); +#if 1 +ulBaudDivisor = ucDataByte = ucTrash = 0; +#endif + pmc68681Context = (mc68681_context *) malloc(sizeof(mc68681_context)); - Console_Port_Data[minor].pDeviceContext=(void *)pmc68681Context; - pmc68681Context->ucModemCtrl=SP_MODEM_IRQ; + Console_Port_Data[minor].pDeviceContext = (void *)pmc68681Context; +#if 0 + pmc68681Context->ucModemCtrl = SP_MODEM_IRQ; +#endif pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; setReg = Console_Port_Tbl[minor].setRegister; getReg = Console_Port_Tbl[minor].getRegister; +#if 0 /* Clear the divisor latch, clear all interrupt enables, * and reset and * disable the FIFO's. */ - (*setReg)(pMC68681, NS68681_LINE_CONTROL, 0x0); - (*setReg)(pMC68681, NS68681_INTERRUPT_ENABLE, 0x0); + (*setReg)(pMC68681, MC68681_LINE_CONTROL, 0x0); + (*setReg)(pMC68681, MC68681_INTERRUPT_ENABLE, 0x0); /* Set the divisor latch and set the baud rate. */ ulBaudDivisor=MC68681_Baud((unsigned32)Console_Port_Tbl[minor].pDeviceParams); ucDataByte = SP_LINE_DLAB; - (*setReg)(pMC68681, NS68681_LINE_CONTROL, ucDataByte); - (*setReg)(pMC68681, NS68681_TRANSMIT_BUFFER, ulBaudDivisor&0xff); - (*setReg)(pMC68681, NS68681_INTERRUPT_ENABLE, (ulBaudDivisor>>8)&0xff); + (*setReg)(pMC68681, MC68681_LINE_CONTROL, ucDataByte); + (*setReg)(pMC68681, MC68681_TRANSMIT_BUFFER, ulBaudDivisor&0xff); + (*setReg)(pMC68681, MC68681_INTERRUPT_ENABLE, (ulBaudDivisor>>8)&0xff); /* Clear the divisor latch and set the character size to eight bits */ /* with one stop bit and no parity checking. */ ucDataByte = EIGHT_BITS; - (*setReg)(pMC68681, NS68681_LINE_CONTROL, ucDataByte); + (*setReg)(pMC68681, MC68681_LINE_CONTROL, ucDataByte); /* Enable and reset transmit and receive FIFOs. TJA */ ucDataByte = SP_FIFO_ENABLE; - (*setReg)(pMC68681, NS68681_FIFO_CONTROL, ucDataByte); + (*setReg)(pMC68681, MC68681_FIFO_CONTROL, ucDataByte); ucDataByte = SP_FIFO_ENABLE | SP_FIFO_RXRST | SP_FIFO_TXRST; - (*setReg)(pMC68681, NS68681_FIFO_CONTROL, ucDataByte); + (*setReg)(pMC68681, MC68681_FIFO_CONTROL, ucDataByte); /* * Disable interrupts */ ucDataByte = 0; - (*setReg)(pMC68681, NS68681_INTERRUPT_ENABLE, ucDataByte); + (*setReg)(pMC68681, MC68681_INTERRUPT_ENABLE, ucDataByte); /* Set data terminal ready. */ /* And open interrupt tristate line */ - (*setReg)(pMC68681, NS68681_MODEM_CONTROL,pmc68681Context->ucModemCtrl); + (*setReg)(pMC68681, MC68681_MODEM_CONTROL,pmc68681Context->ucModemCtrl); - ucTrash = (*getReg)(pMC68681, NS68681_LINE_STATUS ); - ucTrash = (*getReg)(pMC68681, NS68681_RECEIVE_BUFFER ); + ucTrash = (*getReg)(pMC68681, MC68681_LINE_STATUS ); + ucTrash = (*getReg)(pMC68681, MC68681_RECEIVE_BUFFER ); +#endif } static int mc68681_open( @@ -154,6 +156,7 @@ static int mc68681_open( void * arg ) { +/* XXX */ /* * Assert DTR */ @@ -171,6 +174,7 @@ static int mc68681_close( void * arg ) { +/* XXX */ /* * Negate DTR */ @@ -194,25 +198,27 @@ static void mc68681_write_polled( unsigned char ucLineStatus; int iTimeout; getRegister_f getReg; - setRegister_f setReg; + setData_f setData; pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; getReg = Console_Port_Tbl[minor].getRegister; - setReg = Console_Port_Tbl[minor].setRegister; + setData = Console_Port_Tbl[minor].setData; /* * wait for transmitter holding register to be empty */ - iTimeout=1000; - ucLineStatus = (*getReg)(pMC68681, NS68681_LINE_STATUS); - while ((ucLineStatus & SP_LSR_THOLD) == 0) { + iTimeout = 1000; + ucLineStatus = (*getReg)(pMC68681, MC68681_STATUS_REG); + while ((ucLineStatus & MC68681_TX_READY) == 0) { + /* * Yield while we wait */ + if(_System_state_Is_up(_System_state_Get())) { rtems_task_wake_after(RTEMS_YIELD_PROCESSOR); } - ucLineStatus = (*getReg)(pMC68681, NS68681_LINE_STATUS); + ucLineStatus = (*getReg)(pMC68681, MC68681_STATUS_REG); if(!--iTimeout) { break; } @@ -221,23 +227,29 @@ static void mc68681_write_polled( /* * transmit character */ - (*setReg)(pMC68681, NS68681_TRANSMIT_BUFFER, cChar); + + (*setData)(pMC68681, cChar); } /* * These routines provide control of the RTS and DTR lines */ + /* * mc68681_assert_RTS */ + static int mc68681_assert_RTS(int minor) { +/* XXX */ + unsigned32 pMC68681; unsigned32 Irql; - mc68681_context *pns68681Context; + mc68681_context *pmc68681Context; setRegister_f setReg; - pmc68681Context=(ns68681_context *) Console_Port_Data[minor].pDeviceContext; + + pmc68681Context = (mc68681_context *) Console_Port_Data[minor].pDeviceContext; pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; setReg = Console_Port_Tbl[minor].setRegister; @@ -246,8 +258,10 @@ static int mc68681_assert_RTS(int minor) * Assert RTS */ rtems_interrupt_disable(Irql); - pmc68681Context->ucModemCtrl|=SP_MODEM_RTS; - (*setReg)(pMC68681, NS68681_MODEM_CONTROL, pmc68681Context->ucModemCtrl); +#if 0 + pmc68681Context->ucModemCtrl |= SP_MODEM_RTS; + (*setReg)(pMC68681, MC68681_MODEM_CONTROL, pmc68681Context->ucModemCtrl); +#endif rtems_interrupt_enable(Irql); return 0; } @@ -257,12 +271,13 @@ static int mc68681_assert_RTS(int minor) */ static int mc68681_negate_RTS(int minor) { +/* XXX */ unsigned32 pMC68681; unsigned32 Irql; - mc68681_context *pns68681Context; + mc68681_context *pmc68681Context; setRegister_f setReg; - pmc68681Context=(ns68681_context *) Console_Port_Data[minor].pDeviceContext; + pmc68681Context = (mc68681_context *) Console_Port_Data[minor].pDeviceContext; pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; setReg = Console_Port_Tbl[minor].setRegister; @@ -271,8 +286,10 @@ static int mc68681_negate_RTS(int minor) * Negate RTS */ rtems_interrupt_disable(Irql); - pmc68681Context->ucModemCtrl&=~SP_MODEM_RTS; - (*setReg)(pMC68681, NS68681_MODEM_CONTROL, pmc68681Context->ucModemCtrl); +#if 0 + pmc68681Context->ucModemCtrl &= ~SP_MODEM_RTS; + (*setReg)(pMC68681, MC68681_MODEM_CONTROL, pmc68681Context->ucModemCtrl); +#endif rtems_interrupt_enable(Irql); return 0; } @@ -281,17 +298,20 @@ static int mc68681_negate_RTS(int minor) * These flow control routines utilise a connection from the local DTR * line to the remote CTS line */ + /* * mc68681_assert_DTR */ + static int mc68681_assert_DTR(int minor) { +/* XXX */ unsigned32 pMC68681; unsigned32 Irql; - mc68681_context *pns68681Context; + mc68681_context *pmc68681Context; setRegister_f setReg; - pmc68681Context=(ns68681_context *) Console_Port_Data[minor].pDeviceContext; + pmc68681Context = (mc68681_context *) Console_Port_Data[minor].pDeviceContext; pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; setReg = Console_Port_Tbl[minor].setRegister; @@ -300,8 +320,10 @@ static int mc68681_assert_DTR(int minor) * Assert DTR */ rtems_interrupt_disable(Irql); - pmc68681Context->ucModemCtrl|=SP_MODEM_DTR; - (*setReg)(pMC68681, NS68681_MODEM_CONTROL, pmc68681Context->ucModemCtrl); +#if 0 + pmc68681Context->ucModemCtrl |= SP_MODEM_DTR; + (*setReg)(pMC68681, MC68681_MODEM_CONTROL, pmc68681Context->ucModemCtrl); +#endif rtems_interrupt_enable(Irql); return 0; } @@ -309,14 +331,16 @@ static int mc68681_assert_DTR(int minor) /* * mc68681_negate_DTR */ + static int mc68681_negate_DTR(int minor) { +/* XXX */ unsigned32 pMC68681; unsigned32 Irql; - mc68681_context *pns68681Context; + mc68681_context *pmc68681Context; setRegister_f setReg; - pmc68681Context=(ns68681_context *) Console_Port_Data[minor].pDeviceContext; + pmc68681Context = (mc68681_context *) Console_Port_Data[minor].pDeviceContext; pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; setReg = Console_Port_Tbl[minor].setRegister; @@ -325,8 +349,10 @@ static int mc68681_negate_DTR(int minor) * Negate DTR */ rtems_interrupt_disable(Irql); - pmc68681Context->ucModemCtrl&=~SP_MODEM_DTR; - (*setReg)(pMC68681, NS68681_MODEM_CONTROL,pmc68681Context->ucModemCtrl); +#if 0 + pmc68681Context->ucModemCtrl &= ~SP_MODEM_DTR; + (*setReg)(pMC68681, MC68681_MODEM_CONTROL,pmc68681Context->ucModemCtrl); +#endif rtems_interrupt_enable(Irql); return 0; } @@ -334,7 +360,7 @@ static int mc68681_negate_DTR(int minor) /* * mc68681_isr * - * This routine is the console interrupt handler for COM1 and COM2 + * This routine is the console interrupt handler. * * Input parameters: * vector - vector number @@ -348,6 +374,7 @@ static void mc68681_process( int minor ) { +/* XXX */ unsigned32 pMC68681; volatile unsigned8 ucLineStatus; volatile unsigned8 ucInterruptId; @@ -355,20 +382,24 @@ static void mc68681_process( getRegister_f getReg; setRegister_f setReg; +#if 1 +cChar = ucInterruptId = ucLineStatus = 0; +#endif pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; getReg = Console_Port_Tbl[minor].getRegister; setReg = Console_Port_Tbl[minor].setRegister; +#if 0 do { /* * Deal with any received characters */ while(TRUE) { - ucLineStatus = (*getReg)(pMC68681, NS68681_LINE_STATUS); + ucLineStatus = (*getReg)(pMC68681, MC68681_LINE_STATUS); if(~ucLineStatus & SP_LSR_RDY) { break; } - cChar = (*getReg)(pMC68681, NS68681_RECEIVE_BUFFER); + cChar = (*getReg)(pMC68681, MC68681_RECEIVE_BUFFER); rtems_termios_enqueue_raw_characters( Console_Port_Data[minor].termios_data, &cChar, @@ -378,8 +409,8 @@ static void mc68681_process( while(TRUE) { if(Ring_buffer_Is_empty(&Console_Port_Data[minor].TxBuffer)) { - Console_Port_Data[minor].bActive=FALSE; - if(Console_Port_Tbl[minor].pDeviceFlow !=&mc68681_flow_RTSCTS) { + Console_Port_Data[minor].bActive = FALSE; + if(Console_Port_Tbl[minor].pDeviceFlow != &mc68681_flow_RTSCTS) { mc68681_negate_RTS(minor); } @@ -389,7 +420,7 @@ static void mc68681_process( break; } - ucLineStatus = (*getReg)(pMC68681, NS68681_LINE_STATUS); + ucLineStatus = (*getReg)(pMC68681, MC68681_LINE_STATUS); if(~ucLineStatus & SP_LSR_THOLD) { /* * We'll get another interrupt when @@ -403,12 +434,13 @@ static void mc68681_process( /* * transmit character */ - (*setReg)(pMC68681, NS68681_TRANSMIT_BUFFER, cChar); + (*setReg)(pMC68681, MC68681_TRANSMIT_BUFFER, cChar); } - ucInterruptId = (*getReg)(pMC68681, NS68681_INTERRUPT_ID); + ucInterruptId = (*getReg)(pMC68681, MC68681_INTERRUPT_ID); } - while((ucInterruptId&0xf)!=0x1); + while((ucInterruptId&0xf) != 0x1); +#endif } static rtems_isr mc68681_isr( @@ -417,8 +449,8 @@ static rtems_isr mc68681_isr( { int minor; - for(minor=0;minor<Console_Port_Count;minor++) { - if(vector==Console_Port_Tbl[minor].ulIntVector) { + for(minor=0 ; minor<Console_Port_Count ; minor++) { + if(vector == Console_Port_Tbl[minor].ulIntVector) { mc68681_process(minor); } } @@ -427,6 +459,7 @@ static rtems_isr mc68681_isr( /* * mc68681_flush */ + static int mc68681_flush(int major, int minor, void *arg) { while(!Ring_buffer_Is_empty(&Console_Port_Data[minor].TxBuffer)) { @@ -460,19 +493,24 @@ static void mc68681_enable_interrupts( int minor ) { +/* XXX */ unsigned32 pMC68681; unsigned8 ucDataByte; - setRegister_f setReg; + setRegister_f setReg; +#if 1 +ucDataByte = 0; +#endif pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; setReg = Console_Port_Tbl[minor].setRegister; +#if 0 /* * Enable interrupts */ ucDataByte = SP_INT_RX_ENABLE | SP_INT_TX_ENABLE; - (*setReg)(pMC68681, NS68681_INTERRUPT_ENABLE, ucDataByte); - + (*setReg)(pMC68681, MC68681_INTERRUPT_ENABLE, ucDataByte); +#endif } static void mc68681_initialize_interrupts(int minor) @@ -492,8 +530,8 @@ static void mc68681_initialize_interrupts(int minor) * mc68681_write_support_int * * Console Termios output entry point. - * */ + static int mc68681_write_support_int( int minor, const char *buf, @@ -503,7 +541,7 @@ static int mc68681_write_support_int( int i; unsigned32 Irql; - for(i=0; i<len;) { + for(i=0 ; i<len ;) { if(Ring_buffer_Is_full(&Console_Port_Data[minor].TxBuffer)) { if(!Console_Port_Data[minor].bActive) { /* @@ -537,13 +575,14 @@ static int mc68681_write_support_int( /* * Ensure that characters are on the way */ + if(!Console_Port_Data[minor].bActive) { /* * Wake up the device */ rtems_interrupt_disable(Irql); Console_Port_Data[minor].bActive = TRUE; - if(Console_Port_Tbl[minor].pDeviceFlow !=&mc68681_flow_RTSCTS) { + if(Console_Port_Tbl[minor].pDeviceFlow != &mc68681_flow_RTSCTS) { mc68681_assert_RTS(minor); } mc68681_process(minor); @@ -559,6 +598,7 @@ static int mc68681_write_support_int( * Console Termios output entry point. * */ + static int mc68681_write_support_polled( int minor, const char *buf, @@ -598,14 +638,16 @@ static int mc68681_inbyte_nonblocking_polled( unsigned char ucLineStatus; char cChar; getRegister_f getReg; + getData_f getData; pMC68681 = Console_Port_Tbl[minor].ulCtrlPort1; getReg = Console_Port_Tbl[minor].getRegister; + getData = Console_Port_Tbl[minor].getData; - ucLineStatus = (*getReg)(pMC68681, NS68681_LINE_STATUS); - if(ucLineStatus & SP_LSR_RDY) { - cChar = (*getReg)(pMC68681, NS68681_RECEIVE_BUFFER); - return((int)cChar); + ucLineStatus = (*getReg)(pMC68681, MC68681_STATUS_REG); + if(ucLineStatus & MC68681_RX_READY) { + cChar = (*getData)(pMC68681); + return (int)cChar; } else { return(-1); } diff --git a/c/src/lib/libchip/serial/mc68681.h b/c/src/lib/libchip/serial/mc68681.h index 5e46f7d57b..b092eadb1b 100644 --- a/c/src/lib/libchip/serial/mc68681.h +++ b/c/src/lib/libchip/serial/mc68681.h @@ -19,14 +19,23 @@ extern "C" { #endif /* + * These are just used in the interface between this driver and + * the read/write register routines. + */ + +#define MC68681_STATUS_REG 0xFF + +/* * Driver function table */ + extern console_fns mc68681_fns; extern console_fns mc68681_fns_polled; /* * Flow control function tables */ + extern console_flow mc68681_flow_RTSCTS; extern console_flow mc68681_flow_DTRCTS; diff --git a/c/src/lib/libchip/serial/mc68681_p.h b/c/src/lib/libchip/serial/mc68681_p.h index 13af0dc553..75730954c7 100644 --- a/c/src/lib/libchip/serial/mc68681_p.h +++ b/c/src/lib/libchip/serial/mc68681_p.h @@ -18,6 +18,209 @@ extern "C" { #endif +/* + * mc68681 register offsets Read/Write Addresses + */ + +#define MC68681_MODE_REG_1A 0 /* MR1A-MR Prior to Read */ +#define MC68681_MODE_REG_2A 0 /* MR2A-MR After Read */ + +#define MC68681_COUNT_MODE_CURRENT_MSB 6 /* CTU */ +#define MC68681_COUNTER_TIMER_UPPER_REG 6 /* CTU */ +#define MC68681_COUNT_MODE_CURRENT_LSB 7 /* CTL */ +#define MC68681_COUNTER_TIMER_LOWER_REG 7 /* CTL */ +#define MC68681_INTERRUPT_VECTOR_REG 12 /* IVR */ + +#define MC68681_MODE_REG_1B 8 /* MR1B-MR Prior to Read */ +#define MC68681_MODE_REG_2B 8 /* MR2BA-MR After Read */ + +/* + * mc68681 register offsets Read Only Addresses + */ + +#define MC68681_STATUS_REG_A 1 /* SRA */ +#define MC68681_MASK_ISR_REG 2 /* MISR */ +#define MC68681_RECEIVE_BUFFER_A 3 /* RHRA */ +#define MC68681_INPUT_PORT_CHANGE_REG 4 /* IPCR */ +#define MC68681_INTERRUPT_STATUS_REG 5 /* ISR */ +#define MC68681_STATUS_REG_B 9 /* SRB */ +#define MC68681_RECEIVE_BUFFER_B 11 /* RHRB */ +#define MC68681_INPUT_PORT 13 /* IP */ +#define MC68681_START_COUNT_CMD 14 /* SCC */ +#define MC68681_STOP_COUNT_CMD 15 /* STC */ + +/* + * mc68681 register offsets Write Only Addresses + */ + +#define MC68681_CLOCK_SELECT_REG_A 1 /* CSRA */ +#define MC68681_COMMAND_REG_A 2 /* CRA */ +#define MC68681_TRANSMIT_BUFFER_A 3 /* THRA */ +#define MC68681_AUX_CTRL_REG 4 /* ACR */ +#define MC68681_INTERRUPT_MASK_REG 5 /* IMR */ +#define MC68681_CLOCK_SELECT_REG_B 9 /* CSRB */ +#define MC68681_COMMAND_REG_B 10 /* CRB */ +#define MC68681_TRANSMIT_BUFFER_B 11 /* THRB */ +#define MC68681_OUTPUT_PORT_CONFIG_REG 13 /* OPCR */ +#define MC68681_OUTPUT_PORT_SET_REG 14 /* SOPBC */ +#define MC68681_OUTPUT_PORT_RESET_BITS 15 /* COPBC */ + +/* + * DUART Command Register Definitions: + * + * MC68681_COMMAND_REG_A,MC68681_COMMAND_REG_B + */ + +#define MC68681_MODE_REG_ENABLE_RX 0x01 +#define MC68681_MODE_REG_DISABLE_RX 0x02 +#define MC68681_MODE_REG_ENABLE_TX 0x04 +#define MC68681_MODE_REG_DISABLE_TX 0x08 +#define MC68681_MODE_REG_RESET_MR_PTR 0x10 +#define MC68681_MODE_REG_RESET_RX 0x20 +#define MC68681_MODE_REG_RESET_TX 0x30 +#define MC68681_MODE_REG_RESET_ERROR 0x40 +#define MC68681_MODE_REG_RESET_BREAK 0x50 +#define MC68681_MODE_REG_START_BREAK 0x60 +#define MC68681_MODE_REG_STOP_BREAK 0x70 +#define MC68681_MODE_REG_SET_RX_BRG 0x80 +#define MC68681_MODE_REG_CLEAR_RX_BRG 0x90 +#define MC68681_MODE_REG_SET_TX_BRG 0xa0 +#define MC68681_MODE_REG_CLEAR_TX_BRG 0xb0 +#define MC68681_MODE_REG_SET_STANDBY 0xc0 +#define MC68681_MODE_REG_SET_ACTIVE 0xd0 + +/* + * Mode Register Definitions + * + * MC68681_MODE_REG_1A + * MC68681_MODE_REG_1B + */ + +#define MC68681_5BIT_CHARS 0x00 +#define MC68681_6BIT_CHARS 0x01 +#define MC68681_7BIT_CHARS 0x02 +#define MC68681_8BIT_CHARS 0x03 + +#define MC68681_ODD_PARITY 0x00 +#define MC68681_EVEN_PARITY 0x04 + +#define MC68681_WITH_PARITY 0x00 +#define MC68681_FORCE_PARITY 0x08 +#define MC68681_NO_PARITY 0x10 +#define MC68681_MULTI_DROP 0x18 + +#define MC68681_ERR_MODE_CHAR 0x00 +#define MC68681_ERR_MODE_BLOCK 0x20 + +#define MC68681_RX_INTR_RX_READY 0x00 +#define MC68681_RX_INTR_FFULL 0x40 + +#define MC68681_NO_RX_RTS_CTL 0x00 +#define MC68681_RX_RTS_CTRL 0x80 + +/* + * Mode Register Definitions + * + * MC68681_MODE_REG_2A + * MC68681_MODE_REG_2B + */ + +#define MC68681_STOP_BIT_LENGTH__563 0x00 +#define MC68681_STOP_BIT_LENGTH__625 0x01 +#define MC68681_STOP_BIT_LENGTH__688 0x02 +#define MC68681_STOP_BIT_LENGTH__75 0x03 +#define MC68681_STOP_BIT_LENGTH__813 0x04 +#define MC68681_STOP_BIT_LENGTH__875 0x05 +#define MC68681_STOP_BIT_LENGTH__938 0x06 +#define MC68681_STOP_BIT_LENGTH_1 0x07 +#define MC68681_STOP_BIT_LENGTH_1_563 0x08 +#define MC68681_STOP_BIT_LENGTH_1_625 0x09 +#define MC68681_STOP_BIT_LENGTH_1_688 0x0a +#define MC68681_STOP_BIT_LENGTH_1_75 0x0b +#define MC68681_STOP_BIT_LENGTH_1_813 0x0c +#define MC68681_STOP_BIT_LENGTH_1_875 0x0d +#define MC68681_STOP_BIT_LENGTH_1_938 0x0e +#define MC68681_STOP_BIT_LENGTH_2 0x0f + +#define MC68681_CTS_ENABLE_TX 0x10 +#define MC68681_TX_RTS_CTRL 0x20 + +#define MC68681_CHANNEL_MODE_NORMAL 0x00 +#define MC68681_CHANNEL_MODE_ECHO 0x40 +#define MC68681_CHANNEL_MODE_LOCAL_LOOP 0x80 +#define MC68681_CHANNEL_MODE_REMOTE_LOOP 0xc0 + +/* + * Status Register Definitions + * + * MC68681_STATUS_REG_A, MC68681_STATUS_REG_B + */ + +#define MC68681_RX_READY 0x01 +#define MC68681_FFULL 0x02 +#define MC68681_TX_READY 0x04 +#define MC68681_TX_EMPTY 0x08 +#define MC68681_OVERRUN_ERROR 0x10 +#define MC68681_PARITY_ERROR 0x20 +#define MC68681_FRAMING_ERROR 0x40 +#define MC68681_RECEIVED_BREAK 0x80 + +/* + * Interupt Status Register Definitions. + * + * MC68681_INTERRUPT_STATUS_REG + */ + +/* + * Interupt Mask Register Definitions + * + * MC68681_INTERRUPT_MASK_REG + */ + +#define MC68681_IR_TX_READY_A 0x01 +#define MC68681_IR_RX_READY_A 0x02 +#define MC68681_IR_BREAK_A 0x04 +#define MC68681_IR_COUNTER_READY 0x08 +#define MC68681_IR_TX_READY_B 0x10 +#define MC68681_IR_RX_READY_B 0x20 +#define MC68681_IR_BREAK_B 0x40 +#define MC68681_IR_INPUT_PORT_CHANGE 0x80 + +/* + * Status Register Definitions. + * + * MC68681_STATUS_REG_A,MC68681_STATUS_REG_B + */ + +#define MC68681_STATUS_RXRDY 0x01 +#define MC68681_STATUS_FFULL 0x02 +#define MC68681_STATUS_TXRDY 0x04 +#define MC68681_STATUS_TXEMT 0x08 +#define MC68681_STATUS_OVERRUN_ERROR 0x10 +#define MC68681_STATUS_PARITY_ERROR 0x20 +#define MC68681_STATUS_FRAMING_ERROR 0x40 +#define MC68681_STATUS_RECEIVED_BREAK 0x80 + +/* + * Definitions for the Interrupt Vector Register: + * + * MC68681_INTERRUPT_VECTOR_REG + */ + +#define MC68681_INTERRUPT_VECTOR_INIT 0x0f + +/* + * Definitions for the Auxiliary Control Register + * + * MC68681_AUX_CTRL_REG + */ + +#define MC68681_AUX_BRG_SET1 0x00 +#define MC68681_AUX_BRG_SET2 0x80 + +/* + * Per chip context control + */ typedef struct _mc68681_context { @@ -32,36 +235,36 @@ static boolean mc68681_probe(int minor); static void mc68681_init(int minor); static int mc68681_open( - int major, - int minor, - void * arg + int major, + int minor, + void * arg ); static int mc68681_close( - int major, - int minor, - void * arg + int major, + int minor, + void * arg ); static void mc68681_write_polled( - int minor, - char cChar + int minor, + char cChar ); static int mc68681_assert_RTS( - int minor + int minor ); static int mc68681_negate_RTS( - int minor + int minor ); static int mc68681_assert_DTR( - int minor + int minor ); static int mc68681_negate_DTR( - int minor + int minor ); static void mc68681_initialize_interrupts(int minor); @@ -69,19 +272,19 @@ static void mc68681_initialize_interrupts(int minor); static int mc68681_flush(int major, int minor, void *arg); static int mc68681_write_support_int( - int minor, - const char *buf, - int len + int minor, + const char *buf, + int len ); static int mc68681_write_support_polled( - int minor, - const char *buf, - int len - ); + int minor, + const char *buf, + int len + ); static int mc68681_inbyte_nonblocking_polled( - int minor + int minor ); #ifdef __cplusplus |